Molecular Formula: C11H16N2O
Molecular weight: 192.25754
InChi: InChI=1S/C11H16N2O/c1-13(2)9-12-11-5-3-10(4-6-11)7-8-14/h3-6,9,14H,7-8H2,1-2H3/b12-9+
InChi Key: JBUMBBBIICLZAU-FMIVXFBMSA-N
SMILES: c1(ccc(cc1)CCO)/N=C/N(C)C




Authors of compound