Molecular Formula: C22H19BrCl2N2O3
Molecular weight: 510.20786
InChi: InChI=1S/C22H18Cl2N2O3.BrH/c23-15-6-9-17(10-7-15)26-21(27)18-13-16(24)8-11-20(18)29-22(28)19(25)12-14-4-2-1-3-5-14;/h1-11,13,19H,12,25H2,(H,26,27);1H/t19-;/m1./s1
InChi Key: DTZBHRGLTGPZLU-FSRHSHDFSA-N
SMILES: Br.c1(c(OC(=O)[C@@H](Cc2ccccc2)N)ccc(c1)Cl)C(=O)Nc1ccc(cc1)Cl




Authors of compound