Molecular Formula: C15H15N3O4S
Molecular weight: 333.3623
InChi: InChI=1S/C15H15N3O4S/c1-22-15(19)11-7-3-4-8-12(11)16-18-17-13-9-5-6-10-14(13)23(2,20)21/h3-10H,1-2H3,(H,16,17)
InChi Key: CNZCOKYNGXIWEU-UHFFFAOYSA-N
SMILES: c1(c(N/N=N/c2c(C(=O)OC)cccc2)cccc1)S(=O)(=O)C




Authors of compound