Molecular Formula: C19H47B11Cl-
Molecular weight: 429.95048
InChi: InChI=1S/C19H47B11Cl/c1-20-19(17-15-13-12-14-16-18-31)21(20,2)23(19,4)24(19,5)22(19,20,3)26(20,7)25(20,21,6)27(21,23,8)29(23,24,10)28(22,24,26,9)30(25,26,27,29)11/h12-18H2,1-11H3/q-1
InChi Key: MZRSYRKKSYJQGX-UHFFFAOYSA-N
SMILES: [C]1234([B]567([B]891([B]1%103([B]3%114([B]425([B]257([B]768([B]691([B]1%10%11([B]342([B-]5761C)C)C)C)C)C)C)C)C)C)C)CCCCCCCCl




Authors of compound