Molecular Formula: C11H15N5O
Molecular weight: 233.2697
InChi: InChI=1S/C11H15N5O/c12-10-9-11(14-5-13-10)16(6-15-9)7-3-1-2-4-8(7)17/h5-8,17H,1-4H2,(H2,12,13,14)/t7-,8+/m1/s1
InChi Key: YNEOLWHNIDWTLC-SFYZADRCSA-N
SMILES: n1(c2c(nc1)c(ncn2)N)[C@H]1[C@H](CCCC1)O
Chemical Name
9-(cis-2-hydroxycyclohexyl)adenine
cis-2-(6-amino-purin-9-yl)-cyclohexanol
9-(cis-2-hydroxycyclohexyl)adenine
cis-2-(6-amino-purin-9-yl)-cyclohexanol




Authors of compound