Molecular Formula: C19H41NO2
Molecular weight: 315.53434
InChi: InChI=1S/C19H41NO2/c1-9-11-13-20(14-12-10-2)17(21-15-18(3,4)5)22-16-19(6,7)8/h17H,9-16H2,1-8H3
InChi Key: WZIFAFLJXWATDQ-UHFFFAOYSA-N
SMILES: C(COC(N(CCCC)CCCC)OCC(C)(C)C)(C)(C)C
Chemical Name
dibutylformamide dineopentyl acetal
dibutylformamide dineopentyl acetal




Authors of compound