Molecular Formula: C12H16O2
Molecular weight: 192.25424
InChi: InChI=1S/C12H16O2/c1-7(13)14-11-5-4-10-8-2-3-9(6-8)12(10)11/h4-5,8-12H,2-3,6H2,1H3/t8-,9+,10-,11+,12+/m0/s1
InChi Key: IWKVBDHPANGKEX-RNWYCLNJSA-N
SMILES: [C@H]12[C@H]([C@H]3C[C@@H]1CC3)C=C[C@H]2OC(=O)C
Chemical Name
(+-)-1c-Acetoxy-(3arH.7acH)-3a.4.5.6.7.7a-hexahydro-4c.7c-methano-inden
(+-)-1c-acetoxy-(3arH.7acH)-3a.4.5.6.7.7a-hexahydro-4c.7c-methano-indene
1-Acetoxy-endo-5,6-dihydrodicyclopentadien
3a,4,5,6,7,7a-hexahydro-(1α,3aα,4α,7α,7aα)-4,7-methano-1H-inden-1-yl acetate
3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoindenyl acetate
(+-)-1c-Acetoxy-(3arH.7acH)-3a.4.5.6.7.7a-hexahydro-4c.7c-methano-inden
(+-)-1c-acetoxy-(3arH.7acH)-3a.4.5.6.7.7a-hexahydro-4c.7c-methano-indene
1-Acetoxy-endo-5,6-dihydrodicyclopentadien
3a,4,5,6,7,7a-hexahydro-(1α,3aα,4α,7α,7aα)-4,7-methano-1H-inden-1-yl acetate
3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoindenyl acetate




Authors of compound