Molecular Formula: C20H25NO3
Molecular weight: 327.4174
InChi: InChI=1S/C20H25NO3/c1-2-24-19(23)20(11-15-5-3-4-6-16(15)12-20)21-18(22)17-10-13-7-8-14(17)9-13/h3-6,13-14,17H,2,7-12H2,1H3,(H,21,22)
InChi Key: WNJHGNRYXCNPIP-UHFFFAOYSA-N
SMILES: C1(Cc2c(C1)cccc2)(C(=O)OCC)NC(=O)C1C2CC(C1)CC2
Chemical Name
2-[(bicyclo[2.2.1]heptane-2-carbonyl)-amino]-indan-2-carboxylic acid ethyl ester
2-[(bicyclo[2.2.1]heptane-2-carbonyl)-amino]-indan-2-carboxylic acid ethyl ester




Authors of compound