Molecular Formula: C21H23NO3
Molecular weight: 337.41222
InChi: InChI=1S/C21H23NO3/c1-4-25-20(24)21(12-16-7-5-6-8-17(16)13-21)22-19(23)18-10-9-14(2)11-15(18)3/h5-11H,4,12-13H2,1-3H3,(H,22,23)
InChi Key: QOKMPIBJKWLRQY-UHFFFAOYSA-N
SMILES: C1(Cc2c(C1)cccc2)(C(=O)OCC)NC(=O)c1c(cc(cc1)C)C
Chemical Name
2-(2,4-dimethyl-benzoylamino)-indan-2-carboxylic acid ethyl ester
2-(2,4-dimethyl-benzoylamino)-indan-2-carboxylic acid ethyl ester




Authors of compound