Molecular Formula: C13H15FeNO4
Molecular weight: 305.1075
InChi: InChI=1S/C9H11N.4CO.Fe/c1-10(2)8-9-6-4-3-5-7-9;4*1-2;/h3-7H,1-2H3;;;;;
InChi Key: MUPFSYRSUBDYKQ-UHFFFAOYSA-N
SMILES: [Fe](=C(c1ccccc1)N(C)C)(C#[OH])(C#[OH])(C#[OH])C#[OH]
Chemical Name
tetracarbonyl[(N,N-dimethylamino)phenylmethylene]iron(0)
[(N,N-dimethylamino)phenylmethylene]tetracarbonyliron(0)
tetracarbonyl[(N,N-dimethylamino)phenylmethylene]iron(0)
[(N,N-dimethylamino)phenylmethylene]tetracarbonyliron(0)




Authors of compound