Molecular Formula: C6H7ClN2O2
Molecular weight: 174.58498
InChi: InChI=1S/C6H7ClN2O2/c7-6-8-4(2-10)1-5(3-11)9-6/h1,10-11H,2-3H2
InChi Key: ZDISRBRMAYRNOA-UHFFFAOYSA-N
SMILES: c1(cc(nc(n1)Cl)CO)CO




Authors of compound