Molecular Formula: C24H35N7O8
Molecular weight: 549.5768
InChi: InChI=1S/C15H26N4.C6H3N3O7.C3H6O/c1-2-5-15-13-19-11-9-17-7-3-6-16-8-10-18-12-14(15)4-1;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;1-3(2)4/h1-2,4-5,16-19H,3,6-13H2;1-2,10H;1-2H3
InChi Key: VQMJBAJWLVLUKI-UHFFFAOYSA-N
SMILES: C(=O)(C)C.c1(c(cc(cc1N(=O)=O)N(=O)=O)N(=O)=O)O.c12c(cccc1)CNCCNCCCNCCNC2




Authors of compound