Molecular Formula: C34H33N3O2
Molecular weight: 515.64472
InChi: InChI=1S/C34H33N3O2/c1-35(2)25-13-7-22(8-14-25)21-30-33(38)31-28(23-9-15-26(16-10-23)36(3)4)19-20-29(32(31)34(30)39)24-11-17-27(18-12-24)37(5)6/h7-21H,1-6H3
InChi Key: FJHRFHFITNONBV-UHFFFAOYSA-N
SMILES: c12c(c(c3ccc(cc3)N(C)C)ccc1c1ccc(cc1)N(C)C)C(=O)/C(=C\c1ccc(cc1)N(C)C)/C2=O
Chemical Name
2-[4-(N,N-dimethylamino)benzylidene]-4,7-bis[4-(N,N-dimethylamino)phenyl]indan-1,3-dione
2-[4-(N,N-dimethylamino)benzylidene]-4,7-bis[4-(N,N-dimethylamino)phenyl]indan-1,3-dione




Authors of compound