Molecular Formula: C9H12N5NaO6P-
Molecular weight: 340.185011
InChi: InChI=1S/C9H14N5O6P.Na/c10-9-12-7-6(8(16)13-9)11-3-14(7)1-5(2-15)20-4-21(17,18)19;/h3,5,15H,1-2,4H2,(H2,17,18,19)(H3,10,12,13,16);/q;+1/p-2/t5-;/m0./s1
InChi Key: YHHSADBMENLWBZ-JEDNCBNOSA-L
SMILES: c12c(c(nc(n2)N)O)ncn1C[C@H](OCP(=O)([O-])[O-])CO.[Na+]
Chemical Name
disodium salt of 9-(S)-(3-hydroxy-2-phosphonylmethoxypropyl)guanine
disodium salt of 9-(S)-(3-hydroxy-2-phosphonylmethoxypropyl)guanine




Authors of compound