Molecular Formula: C12H17N5O3
Molecular weight: 279.29508
InChi: InChI=1S/C12H17N5O3/c1-12(2)19-7(8(4-18)20-12)3-17-6-16-9-10(13)14-5-15-11(9)17/h5-8,18H,3-4H2,1-2H3,(H2,13,14,15)/t7-,8+/m0/s1
InChi Key: SPXMBAQNKYIIRA-JGVFFNPUSA-N
SMILES: C1(O[C@H]([C@H](O1)CO)Cn1c2c(nc1)c(ncn2)N)(C)C
Chemical Name
9-(2S,3R)-erythro-(2,3-O-isopropylidene-2,3,4-trihydroxybutyl)adenine
9-[(2'S,3'R)-4'-hydroxy-2',3'-isopropylidenedioxybutyl]adenine
9-(2S,3R)-erythro-(2,3-O-isopropylidene-2,3,4-trihydroxybutyl)adenine
9-[(2'S,3'R)-4'-hydroxy-2',3'-isopropylidenedioxybutyl]adenine




Authors of compound